C7H9N3 — CID 91017102
3,4,4a,8a-tetrahydropyrido[2,3-b]pyrazine (PubChem CID 91017102) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 3,4,4a,8a-tetrahydropyrido[2,3-b]pyrazine.
| Compound Name | 3,4,4a,8a-tetrahydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 91017102 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3,4,4a,8a-tetrahydropyrido[2,3-b]pyrazine |
| SMILES | C1=CC2N=CCNC2N=C1 |
| InChI | InChI=1S/C7H9N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-4,6-7,10H,5H2 |
| InChIKey | ZAIYDHLBFNPSEH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |