C7H13N3 — CID 141225359
3-N,3-N'-dimethyl-2H-pyridine-3,3-diamine (PubChem CID 141225359) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-N,3-N'-dimethyl-2H-pyridine-3,3-diamine.
| Compound Name | 3-N,3-N'-dimethyl-2H-pyridine-3,3-diamine |
|---|---|
| PubChem CID | 141225359 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 3-N,3-N'-dimethyl-2H-pyridine-3,3-diamine |
| SMILES | CNC1(NC)C=CC=NC1 |
| InChI | InChI=1S/C7H13N3/c1-8-7(9-2)4-3-5-10-6-7/h3-5,8-9H,6H2,1-2H3 |
| InChIKey | PTEMDNWLXQZURG-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|