C7H12N2 — CID 163971056
N,2-dimethyl-3H-pyridin-2-amine (PubChem CID 163971056) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is N,2-dimethyl-3H-pyridin-2-amine.
| Compound Name | N,2-dimethyl-3H-pyridin-2-amine |
|---|---|
| PubChem CID | 163971056 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,2-dimethyl-3H-pyridin-2-amine |
| SMILES | CNC1(C)CC=CC=N1 |
| InChI | InChI=1S/C7H12N2/c1-7(8-2)5-3-4-6-9-7/h3-4,6,8H,5H2,1-2H3 |
| InChIKey | SQAFAKAHAABQNE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |