C6H11N3 — CID 163541354
2-N-methyl-2,3-dihydropyridine-2,3-diamine (PubChem CID 163541354) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-N-methyl-2,3-dihydropyridine-2,3-diamine.
| Compound Name | 2-N-methyl-2,3-dihydropyridine-2,3-diamine |
|---|---|
| PubChem CID | 163541354 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-N-methyl-2,3-dihydropyridine-2,3-diamine |
| SMILES | CNC1N=CC=CC1N |
| InChI | InChI=1S/C6H11N3/c1-8-6-5(7)3-2-4-9-6/h2-6,8H,7H2,1H3 |
| InChIKey | FBIMRLRTJKSJGP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |