C9H17N3 — CID 141225361
3-N,3-N'-diethyl-2H-pyridine-3,3-diamine (PubChem CID 141225361) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3-N,3-N'-diethyl-2H-pyridine-3,3-diamine.
| Compound Name | 3-N,3-N'-diethyl-2H-pyridine-3,3-diamine |
|---|---|
| PubChem CID | 141225361 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3-N,3-N'-diethyl-2H-pyridine-3,3-diamine |
| SMILES | CCNC1(NCC)C=CC=NC1 |
| InChI | InChI=1S/C9H17N3/c1-3-11-9(12-4-2)6-5-7-10-8-9/h5-7,11-12H,3-4,8H2,1-2H3 |
| InChIKey | ANJUNJGYVSCMAL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|