C11H21N3 — CID 141225360
3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine (PubChem CID 141225360) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine.
| Compound Name | 3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine |
|---|---|
| PubChem CID | 141225360 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3-N,3-N'-di(propan-2-yl)-2H-pyridine-3,3-diamine |
| SMILES | CC(C)NC1(NC(C)C)C=CC=NC1 |
| InChI | InChI=1S/C11H21N3/c1-9(2)13-11(14-10(3)4)6-5-7-12-8-11/h5-7,9-10,13-14H,8H2,1-4H3 |
| InChIKey | JGQDQXPSEZQOJZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|