C9H16N2 — CID 142173291
N-(2,3-dihydropyridin-2-ylmethyl)propan-2-amine (PubChem CID 142173291) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-2-ylmethyl)propan-2-amine.
| Compound Name | N-(2,3-dihydropyridin-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 142173291 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-(2,3-dihydropyridin-2-ylmethyl)propan-2-amine |
| SMILES | CC(C)NCC1CC=CC=N1 |
| InChI | InChI=1S/C9H16N2/c1-8(2)11-7-9-5-3-4-6-10-9/h3-4,6,8-9,11H,5,7H2,1-2H3 |
| InChIKey | IUAMLYSIVRJHAX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |