C9H19N3 — CID 123781675
N'-(3-methyl-5-methyliminopent-3-en-2-yl)ethane-1,2-diamine (PubChem CID 123781675) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is N'-(3-methyl-5-methyliminopent-3-en-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(3-methyl-5-methyliminopent-3-en-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123781675 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N'-(3-methyl-5-methyliminopent-3-en-2-yl)ethane-1,2-diamine |
| SMILES | C/N=C/C=C(C)C(C)NCCN |
| InChI | InChI=1S/C9H19N3/c1-8(4-6-11-3)9(2)12-7-5-10/h4,6,9,12H,5,7,10H2,1-3H3/b8-4?,11-6+ |
| InChIKey | XKIIXPDEYRMVOE-LKIIXXQHSA-N |
| XLogP | 0.57 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|