C19H37N3 — CID 123688446
N-[1-[2-(ethylamino)ethylimino]propan-2-yl]-2,8-dimethyldeca-2,7-dien-4-amine (PubChem CID 123688446) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is N-[1-[2-(ethylamino)ethylimino]propan-2-yl]-2,8-dimethyldeca-2,7-dien-4-amine.
| Compound Name | N-[1-[2-(ethylamino)ethylimino]propan-2-yl]-2,8-dimethyldeca-2,7-dien-4-amine |
|---|---|
| PubChem CID | 123688446 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | N-[1-[2-(ethylamino)ethylimino]propan-2-yl]-2,8-dimethyldeca-2,7-dien-4-amine |
| SMILES | CCNCC/N=C/C(C)NC(C=C(C)C)CCC=C(C)CC |
| InChI | InChI=1S/C19H37N3/c1-7-17(5)10-9-11-19(14-16(3)4)22-18(6)15-21-13-12-20-8-2/h10,14-15,18-20,22H,7-9,11-13H2,1-6H3/b17-10?,21-15+ |
| InChIKey | BLCUPYRPVMCYJC-FJLGTMEZSA-N |
| XLogP | 4.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|