C10H16N2 — CID 166901468
N-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)prop-2-en-1-imine (PubChem CID 166901468) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)prop-2-en-1-imine.
| Compound Name | N-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 166901468 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-(2,4-dimethyl-1,2,3,6-tetrahydropyridin-5-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C1=C(C)CC(C)NC1 |
| InChI | InChI=1S/C10H16N2/c1-4-5-11-10-7-12-9(3)6-8(10)2/h4-5,9,12H,1,6-7H2,2-3H3/b11-5+ |
| InChIKey | UTNGSLRZOUZKDE-VZUCSPMQSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|