C13H23N3 — CID 123262214
N-(2,3-dihydropyridin-2-ylmethyl)-2-ethyliminopentan-1-amine (PubChem CID 123262214) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-2-ylmethyl)-2-ethyliminopentan-1-amine.
| Compound Name | N-(2,3-dihydropyridin-2-ylmethyl)-2-ethyliminopentan-1-amine |
|---|---|
| PubChem CID | 123262214 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N-(2,3-dihydropyridin-2-ylmethyl)-2-ethyliminopentan-1-amine |
| SMILES | CCC/C(CNCC1CC=CC=N1)=N\CC |
| InChI | InChI=1S/C13H23N3/c1-3-7-12(15-4-2)10-14-11-13-8-5-6-9-16-13/h5-6,9,13-14H,3-4,7-8,10-11H2,1-2H3/b15-12+ |
| InChIKey | YDEKEOMTCFQQPR-NTCAYCPXSA-N |
| XLogP | 2.24 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|