C12H23N3 — CID 90763652
ethane;2-[2-(3H-pyrrol-5-yl)ethyl]piperazine (PubChem CID 90763652) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is ethane;2-[2-(3H-pyrrol-5-yl)ethyl]piperazine.
| Compound Name | ethane;2-[2-(3H-pyrrol-5-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 90763652 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | ethane;2-[2-(3H-pyrrol-5-yl)ethyl]piperazine |
| SMILES | C1=NC(CCC2CNCCN2)=CC1.CC |
| InChI | InChI=1S/C10H17N3.C2H6/c1-2-9(12-5-1)3-4-10-8-11-6-7-13-10;1-2/h2,5,10-11,13H,1,3-4,6-8H2;1-2H3 |
| InChIKey | WNMMZFPKMVXYAT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |