C12H21N3 — CID 123300753
1-[1-(2,3-dihydropyridin-4-yl)propyl]piperazine (PubChem CID 123300753) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[1-(2,3-dihydropyridin-4-yl)propyl]piperazine.
| Compound Name | 1-[1-(2,3-dihydropyridin-4-yl)propyl]piperazine |
|---|---|
| PubChem CID | 123300753 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-[1-(2,3-dihydropyridin-4-yl)propyl]piperazine |
| SMILES | CCC(C1=CC=NCC1)N1CCNCC1 |
| InChI | InChI=1S/C12H21N3/c1-2-12(11-3-5-13-6-4-11)15-9-7-14-8-10-15/h3,5,12,14H,2,4,6-10H2,1H3 |
| InChIKey | AYAOQFLUHRMRIQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |