C16H29N3 — CID 172654060
3,7-dimethyl-N-(2-piperazin-1-ylethyl)octa-2,6-dien-1-imine (PubChem CID 172654060) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 3,7-dimethyl-N-(2-piperazin-1-ylethyl)octa-2,6-dien-1-imine.
| Compound Name | 3,7-dimethyl-N-(2-piperazin-1-ylethyl)octa-2,6-dien-1-imine |
|---|---|
| PubChem CID | 172654060 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 3,7-dimethyl-N-(2-piperazin-1-ylethyl)octa-2,6-dien-1-imine |
| SMILES | CC(C)=CCCC(C)=C/C=N/CCN1CCNCC1 |
| InChI | InChI=1S/C16H29N3/c1-15(2)5-4-6-16(3)7-8-17-9-12-19-13-10-18-11-14-19/h5,7-8,18H,4,6,9-14H2,1-3H3/b16-7?,17-8+ |
| InChIKey | BYIHQXKUTMFOSW-QQCNWCFDSA-N |
| XLogP | 2.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|