C13H19N2+ — CID 20672907
1-(3,5-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)piperazin-1-ium (PubChem CID 20672907) has the molecular formula C13H19N2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(3,5-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)piperazin-1-ium.
| Compound Name | 1-(3,5-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)piperazin-1-ium |
|---|---|
| PubChem CID | 20672907 |
| Molecular Formula | C13H19N2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-(3,5-dimethyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)piperazin-1-ium |
| SMILES | C=C1C(C)=CC(=[N+]2CCNCC2)C=C1C |
| InChI | InChI=1S/C13H19N2/c1-10-8-13(9-11(2)12(10)3)15-6-4-14-5-7-15/h8-9,14H,3-7H2,1-2H3/q+1 |
| InChIKey | GTVKGBZUOOIHQK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|