C16H28N4 — CID 145023390
1-N,2-N-dimethyl-4-(1-piperazin-1-ylethyl)cyclohexa-3,5-diene-1,2-diimine;ethane (PubChem CID 145023390) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-4-(1-piperazin-1-ylethyl)cyclohexa-3,5-diene-1,2-diimine;ethane.
| Compound Name | 1-N,2-N-dimethyl-4-(1-piperazin-1-ylethyl)cyclohexa-3,5-diene-1,2-diimine;ethane |
|---|---|
| PubChem CID | 145023390 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1-N,2-N-dimethyl-4-(1-piperazin-1-ylethyl)cyclohexa-3,5-diene-1,2-diimine;ethane |
| SMILES | C/N=C1\C=CC(C(C)N2CCNCC2)=C\C1=N/C.CC |
| InChI | InChI=1S/C14H22N4.C2H6/c1-11(18-8-6-17-7-9-18)12-4-5-13(15-2)14(10-12)16-3;1-2/h4-5,10-11,17H,6-9H2,1-3H3;1-2H3/b15-13+,16-14+; |
| InChIKey | ISAYTZYMTBJLHD-ACJWTMPUSA-N |
| XLogP | 1.94 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|