C15H27N2+ — CID 169207766
1-ethenylcyclohexa-1,3-diene;1-ethyl-1-methylpiperazin-1-ium (PubChem CID 169207766) has the molecular formula C15H27N2+ and a molecular weight of 235.39 g/mol. Its IUPAC name is 1-ethenylcyclohexa-1,3-diene;1-ethyl-1-methylpiperazin-1-ium.
| Compound Name | 1-ethenylcyclohexa-1,3-diene;1-ethyl-1-methylpiperazin-1-ium |
|---|---|
| PubChem CID | 169207766 |
| Molecular Formula | C15H27N2+ |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.22 |
| IUPAC Name | 1-ethenylcyclohexa-1,3-diene;1-ethyl-1-methylpiperazin-1-ium |
| SMILES | C=CC1=CC=CCC1.CC[N+]1(C)CCNCC1 |
| InChI | InChI=1S/C8H10.C7H17N2/c1-2-8-6-4-3-5-7-8;1-3-9(2)6-4-8-5-7-9/h2-4,6H,1,5,7H2;8H,3-7H2,1-2H3/q;+1 |
| InChIKey | RFQYBVJMRGFBPE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|