C11H18N2 — CID 23453941
1-(cyclohexa-2,4-dien-1-ylmethyl)piperazine (PubChem CID 23453941) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(cyclohexa-2,4-dien-1-ylmethyl)piperazine.
| Compound Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)piperazine |
|---|---|
| PubChem CID | 23453941 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)piperazine |
| SMILES | C1=CCC(CN2CCNCC2)C=C1 |
| InChI | InChI=1S/C11H18N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13/h1-4,11-12H,5-10H2 |
| InChIKey | CYYCWSCGXQSULJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |