About lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine
lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine (PubChem CID 176707625) has the molecular formula C11H17LiN2-2
and a molecular weight of 184.21 g/mol. Its IUPAC name is lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine.
Molecular Properties
| Compound Name | lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine |
| PubChem CID | 176707625 |
| Molecular Formula | C11H17LiN2-2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine |
| SMILES | Cc1c[c-]c(C)nc1.[CH2-]CNC[CH2-].[Li+] |
| InChI | InChI=1S/C7H8N.C4H9N.Li/c1-6-3-4-7(2)8-5-6;1-3-5-4-2;/h3,5H,1-2H3;5H,1-4H2;/q-1;-2;+1 |
| InChIKey | SXLLEYFPULRFNI-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine?
The IUPAC name of lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine (CID 176707625) is lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine.
What is the SMILES notation for lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine?
The canonical SMILES for lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine is Cc1c[c-]c(C)nc1.[CH2-]CNC[CH2-].[Li+].
What is the InChIKey of lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine?
The InChIKey is SXLLEYFPULRFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.C4H9N.Li/c1-6-3-4-7(2)8-5-6;1-3-5-4-2;/h3,5H,1-2H3;5H,1-4H2;/q-1;-2;+1.
What are the key properties of lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine?
lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine has a molecular weight of 184.21 g/mol, XLogP of -1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2,5-dimethyl-3H-pyridin-3-ide;N-ethylethanamine is sourced from PubChem (CID 176707625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).