C15H28N3+ — CID 91807105
4-[2-(2,3-dihydropyridin-4-yl)ethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium (PubChem CID 91807105) has the molecular formula C15H28N3+ and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-[2-(2,3-dihydropyridin-4-yl)ethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium.
| Compound Name | 4-[2-(2,3-dihydropyridin-4-yl)ethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium |
|---|---|
| PubChem CID | 91807105 |
| Molecular Formula | C15H28N3+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 4-[2-(2,3-dihydropyridin-4-yl)ethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium |
| SMILES | CC(C)[N+]1(C)CCN(CCC2=CC=NCC2)CC1 |
| InChI | InChI=1S/C15H28N3/c1-14(2)18(3)12-10-17(11-13-18)9-6-15-4-7-16-8-5-15/h4,7,14H,5-6,8-13H2,1-3H3/q+1 |
| InChIKey | NCCPADMAIQRNHT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|