C10H16N2 — CID 23356626
3-piperidin-1-yl-2,3-dihydropyridine (PubChem CID 23356626) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-piperidin-1-yl-2,3-dihydropyridine.
| Compound Name | 3-piperidin-1-yl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 23356626 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-piperidin-1-yl-2,3-dihydropyridine |
| SMILES | C1=CC(N2CCCCC2)CN=C1 |
| InChI | InChI=1S/C10H16N2/c1-2-7-12(8-3-1)10-5-4-6-11-9-10/h4-6,10H,1-3,7-9H2 |
| InChIKey | PZMZGTXWRGMZSF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |