C18H24N2-2 — CID 170733205
1-cyclopentyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide (PubChem CID 170733205) has the molecular formula C18H24N2-2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-cyclopentyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide.
| Compound Name | 1-cyclopentyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide |
|---|---|
| PubChem CID | 170733205 |
| Molecular Formula | C18H24N2-2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-cyclopentyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide |
| SMILES | Cc1c[c-](C)cc(C)c1=[N+]1[CH-]C=[N+](C2CCCC2)[CH-][CH-]1 |
| InChI | InChI=1S/C18H24N2/c1-14-12-15(2)18(16(3)13-14)20-10-8-19(9-11-20)17-6-4-5-7-17/h8-13,17H,4-7H2,1-3H3/q-2 |
| InChIKey | RUGFTTYCHRCVEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|