C19H26N2-2 — CID 170733202
1-cyclohexyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide (PubChem CID 170733202) has the molecular formula C19H26N2-2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-cyclohexyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide.
| Compound Name | 1-cyclohexyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide |
|---|---|
| PubChem CID | 170733202 |
| Molecular Formula | C19H26N2-2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-cyclohexyl-4-(2,4,6-trimethylcyclohexa-2,5-dien-1-ylidene)-3,5-dihydro-2H-pyrazine-1,4-diium-2,3,5-triide |
| SMILES | Cc1c[c-](C)cc(C)c1=[N+]1[CH-]C=[N+](C2CCCCC2)[CH-][CH-]1 |
| InChI | InChI=1S/C19H26N2/c1-15-13-16(2)19(17(3)14-15)21-11-9-20(10-12-21)18-7-5-4-6-8-18/h9-14,18H,4-8H2,1-3H3/q-2 |
| InChIKey | GDSBCROHDIFSCU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|