C13H24N2 — CID 143059291
4-ethylidene-1-methylpiperidine;N-methylbut-3-en-1-imine (PubChem CID 143059291) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-ethylidene-1-methylpiperidine;N-methylbut-3-en-1-imine.
| Compound Name | 4-ethylidene-1-methylpiperidine;N-methylbut-3-en-1-imine |
|---|---|
| PubChem CID | 143059291 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4-ethylidene-1-methylpiperidine;N-methylbut-3-en-1-imine |
| SMILES | C=CC/C=N/C.CC=C1CCN(C)CC1 |
| InChI | InChI=1S/C8H15N.C5H9N/c1-3-8-4-6-9(2)7-5-8;1-3-4-5-6-2/h3H,4-7H2,1-2H3;3,5H,1,4H2,2H3/b;6-5+ |
| InChIKey | GZKFPOBSSYAZRK-MXDQRGINSA-N |
| XLogP | 2.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|