C15H32N2 — CID 143171835
(E)-N,3-dimethylhex-4-en-1-imine;methane;1-methylpiperidine (PubChem CID 143171835) has the molecular formula C15H32N2 and a molecular weight of 240.44 g/mol. Its IUPAC name is (E)-N,3-dimethylhex-4-en-1-imine;methane;1-methylpiperidine.
| Compound Name | (E)-N,3-dimethylhex-4-en-1-imine;methane;1-methylpiperidine |
|---|---|
| PubChem CID | 143171835 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | (E)-N,3-dimethylhex-4-en-1-imine;methane;1-methylpiperidine |
| SMILES | C.C/C=C/C(C)C/C=N/C.CN1CCCCC1 |
| InChI | InChI=1S/C8H15N.C6H13N.CH4/c1-4-5-8(2)6-7-9-3;1-7-5-3-2-4-6-7;/h4-5,7-8H,6H2,1-3H3;2-6H2,1H3;1H4/b5-4+,9-7+;; |
| InChIKey | BTSNCSSTNOVMKQ-QBKCMBCUSA-N |
| XLogP | 4.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|