C21H38N2 — CID 162360969
ethane;N-methylethanimine;1-methyl-4-[(2Z,4Z)-3-methyl-6-methylideneocta-2,4,7-trien-4-yl]piperidine (PubChem CID 162360969) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is ethane;N-methylethanimine;1-methyl-4-[(2Z,4Z)-3-methyl-6-methylideneocta-2,4,7-trien-4-yl]piperidine.
| Compound Name | ethane;N-methylethanimine;1-methyl-4-[(2Z,4Z)-3-methyl-6-methylideneocta-2,4,7-trien-4-yl]piperidine |
|---|---|
| PubChem CID | 162360969 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | ethane;N-methylethanimine;1-methyl-4-[(2Z,4Z)-3-methyl-6-methylideneocta-2,4,7-trien-4-yl]piperidine |
| SMILES | C/C=N/C.C=CC(=C)/C=C(C(\C)=C/C)/C1CCN(C)CC1.CC |
| InChI | InChI=1S/C16H25N.C3H7N.C2H6/c1-6-13(3)12-16(14(4)7-2)15-8-10-17(5)11-9-15;1-3-4-2;1-2/h6-7,12,15H,1,3,8-11H2,2,4-5H3;3H,1-2H3;1-2H3/b14-7-,16-12+;4-3+; |
| InChIKey | KNPQKDBRAPZMKI-PDVOJGPHSA-N |
| XLogP | 5.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|