C12H22N2 — CID 123885206
N,3-dimethyl-4-(1-methylpiperidin-4-yl)but-2-en-1-imine (PubChem CID 123885206) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N,3-dimethyl-4-(1-methylpiperidin-4-yl)but-2-en-1-imine.
| Compound Name | N,3-dimethyl-4-(1-methylpiperidin-4-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 123885206 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N,3-dimethyl-4-(1-methylpiperidin-4-yl)but-2-en-1-imine |
| SMILES | C/N=C/C=C(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C12H22N2/c1-11(4-7-13-2)10-12-5-8-14(3)9-6-12/h4,7,12H,5-6,8-10H2,1-3H3/b11-4?,13-7+ |
| InChIKey | GQRKYLMEBVDCDH-FDYPENFWSA-N |
| XLogP | 2.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|