C12H20N2 — CID 91459524
5-methyl-3-(piperidin-4-ylmethyl)-2,3-dihydropyridine (PubChem CID 91459524) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-methyl-3-(piperidin-4-ylmethyl)-2,3-dihydropyridine.
| Compound Name | 5-methyl-3-(piperidin-4-ylmethyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 91459524 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-methyl-3-(piperidin-4-ylmethyl)-2,3-dihydropyridine |
| SMILES | CC1=CC(CC2CCNCC2)CN=C1 |
| InChI | InChI=1S/C12H20N2/c1-10-6-12(9-14-8-10)7-11-2-4-13-5-3-11/h6,8,11-13H,2-5,7,9H2,1H3 |
| InChIKey | WSYPHDGYMGIPAV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |