About 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine
2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine (PubChem CID 91022622) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine |
| PubChem CID | 91022622 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine |
| SMILES | COC1CC=C(CC2CCNCC2)C=N1 |
| InChI | InChI=1S/C12H20N2O/c1-15-12-3-2-11(9-14-12)8-10-4-6-13-7-5-10/h2,9-10,12-13H,3-8H2,1H3 |
| InChIKey | JDMDPFKUUATRBC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine?
The IUPAC name of 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine (CID 91022622) is 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine.
What is the SMILES notation for 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine?
The canonical SMILES for 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine is COC1CC=C(CC2CCNCC2)C=N1.
What is the InChIKey of 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine?
The InChIKey is JDMDPFKUUATRBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-15-12-3-2-11(9-14-12)8-10-4-6-13-7-5-10/h2,9-10,12-13H,3-8H2,1H3.
What are the key properties of 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine?
2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine has a molecular weight of 208.31 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(piperidin-4-ylmethyl)-2,3-dihydropyridine is sourced from PubChem (CID 91022622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).