About 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine
1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine (PubChem CID 163927262) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine.
Molecular Properties
| Compound Name | 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine |
| PubChem CID | 163927262 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine |
| SMILES | CC[C@H]1CNC[C@@H](CNCOCC/C=C\C=N\C)C1 |
| InChI | InChI=1S/C15H29N3O/c1-3-14-9-15(11-17-10-14)12-18-13-19-8-6-4-5-7-16-2/h4-5,7,14-15,17-18H,3,6,8-13H2,1-2H3/b5-4-,16-7+/t14-,15+/m1/s1 |
| InChIKey | RFOMEWHQBYBFDL-NUXTUIOCSA-N |
| XLogP | 1.83 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine?
The IUPAC name of 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine (CID 163927262) is 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine.
What is the SMILES notation for 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine?
The canonical SMILES for 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine is CC[C@H]1CNC[C@@H](CNCOCC/C=C\C=N\C)C1.
What is the InChIKey of 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine?
The InChIKey is RFOMEWHQBYBFDL-NUXTUIOCSA-N. The full InChI is InChI=1S/C15H29N3O/c1-3-14-9-15(11-17-10-14)12-18-13-19-8-6-4-5-7-16-2/h4-5,7,14-15,17-18H,3,6,8-13H2,1-2H3/b5-4-,16-7+/t14-,15+/m1/s1.
What are the key properties of 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine?
1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine has a molecular weight of 267.42 g/mol, XLogP of 1.83, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,5R)-5-ethylpiperidin-3-yl]-N-[[(Z)-5-methyliminopent-3-enoxy]methyl]methanamine is sourced from PubChem (CID 163927262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).