C12H22N2O — CID 143984951
2-methoxy-5-(piperidin-4-ylmethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 143984951) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-methoxy-5-(piperidin-4-ylmethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-methoxy-5-(piperidin-4-ylmethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 143984951 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-methoxy-5-(piperidin-4-ylmethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | COC1CC=C(CC2CCNCC2)CN1 |
| InChI | InChI=1S/C12H22N2O/c1-15-12-3-2-11(9-14-12)8-10-4-6-13-7-5-10/h2,10,12-14H,3-9H2,1H3 |
| InChIKey | TVOYOBPDHQNDIR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|