C11H21NO — CID 68830723
1,2,3,4,4a,5,6,7-octahydroisoquinoline;methoxymethane (PubChem CID 68830723) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7-octahydroisoquinoline;methoxymethane.
| Compound Name | 1,2,3,4,4a,5,6,7-octahydroisoquinoline;methoxymethane |
|---|---|
| PubChem CID | 68830723 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7-octahydroisoquinoline;methoxymethane |
| SMILES | C1=C2CNCCC2CCC1.COC |
| InChI | InChI=1S/C9H15N.C2H6O/c1-2-4-9-7-10-6-5-8(9)3-1;1-3-2/h4,8,10H,1-3,5-7H2;1-2H3 |
| InChIKey | XVNLYTLDJRKTMK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|