C14H22N2 — CID 123822692
2-ethenyl-N-(piperidin-4-ylmethyl)hexa-2,4-dien-1-imine (PubChem CID 123822692) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-ethenyl-N-(piperidin-4-ylmethyl)hexa-2,4-dien-1-imine.
| Compound Name | 2-ethenyl-N-(piperidin-4-ylmethyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123822692 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-ethenyl-N-(piperidin-4-ylmethyl)hexa-2,4-dien-1-imine |
| SMILES | C=CC(=CC=CC)/C=N/CC1CCNCC1 |
| InChI | InChI=1S/C14H22N2/c1-3-5-6-13(4-2)11-16-12-14-7-9-15-10-8-14/h3-6,11,14-15H,2,7-10,12H2,1H3/b5-3?,13-6?,16-11+ |
| InChIKey | BQDUKYFKFTXLOE-UAIONEDDSA-N |
| XLogP | 2.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|