C22H34N2 — CID 145300567
(2Z,3E,5E)-5-ethenyl-3,6-dimethyl-2-(2-methylprop-2-enylidene)octa-3,5,7-trien-1-imine;4-methylpiperidine (PubChem CID 145300567) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (2Z,3E,5E)-5-ethenyl-3,6-dimethyl-2-(2-methylprop-2-enylidene)octa-3,5,7-trien-1-imine;4-methylpiperidine.
| Compound Name | (2Z,3E,5E)-5-ethenyl-3,6-dimethyl-2-(2-methylprop-2-enylidene)octa-3,5,7-trien-1-imine;4-methylpiperidine |
|---|---|
| PubChem CID | 145300567 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | (2Z,3E,5E)-5-ethenyl-3,6-dimethyl-2-(2-methylprop-2-enylidene)octa-3,5,7-trien-1-imine;4-methylpiperidine |
| SMILES | CC1CCNCC1.[H]/N=C/C(=C\C(=C)C)/C(C)=C/C(C=C)=C(\C)C=C |
| InChI | InChI=1S/C16H21N.C6H13N/c1-7-13(5)15(8-2)10-14(6)16(11-17)9-12(3)4;1-6-2-4-7-5-3-6/h7-11,17H,1-3H2,4-6H3;6-7H,2-5H2,1H3/b14-10+,15-13+,16-9+,17-11+; |
| InChIKey | IGGDQLTVAPLBPB-WAIGSHHFSA-N |
| XLogP | 5.78 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|