C17H35N — CID 177246247
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine (PubChem CID 177246247) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine.
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 177246247 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine |
| SMILES | C=C/C=C(\C=C)C1CCNCC1.CC.CC.CC |
| InChI | InChI=1S/C11H17N.3C2H6/c1-3-5-10(4-2)11-6-8-12-9-7-11;3*1-2/h3-5,11-12H,1-2,6-9H2;3*1-2H3/b10-5+;;; |
| InChIKey | BHDMQDKZMMZOTM-RWWJYAHQSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|