C19H41N — CID 143651450
ethane;ethene;4-[(2Z,4Z)-hexa-2,4-dien-3-yl]piperidine (PubChem CID 143651450) has the molecular formula C19H41N and a molecular weight of 283.54 g/mol. Its IUPAC name is ethane;ethene;4-[(2Z,4Z)-hexa-2,4-dien-3-yl]piperidine.
| Compound Name | ethane;ethene;4-[(2Z,4Z)-hexa-2,4-dien-3-yl]piperidine |
|---|---|
| PubChem CID | 143651450 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | ethane;ethene;4-[(2Z,4Z)-hexa-2,4-dien-3-yl]piperidine |
| SMILES | C/C=C\C(=C/C)C1CCNCC1.C=C.CC.CC.CC |
| InChI | InChI=1S/C11H19N.3C2H6.C2H4/c1-3-5-10(4-2)11-6-8-12-9-7-11;4*1-2/h3-5,11-12H,6-9H2,1-2H3;3*1-2H3;1-2H2/b5-3-,10-4+;;;; |
| InChIKey | QUDZPUZOAONMJT-LQXMMWTLSA-N |
| XLogP | 6.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|