C19H39N — CID 142165942
ethane;2-methylbut-2-ene;4-[(3Z)-penta-1,3-dien-2-yl]piperidine (PubChem CID 142165942) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is ethane;2-methylbut-2-ene;4-[(3Z)-penta-1,3-dien-2-yl]piperidine.
| Compound Name | ethane;2-methylbut-2-ene;4-[(3Z)-penta-1,3-dien-2-yl]piperidine |
|---|---|
| PubChem CID | 142165942 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | ethane;2-methylbut-2-ene;4-[(3Z)-penta-1,3-dien-2-yl]piperidine |
| SMILES | C=C(/C=C\C)C1CCNCC1.CC.CC.CC=C(C)C |
| InChI | InChI=1S/C10H17N.C5H10.2C2H6/c1-3-4-9(2)10-5-7-11-8-6-10;1-4-5(2)3;2*1-2/h3-4,10-11H,2,5-8H2,1H3;4H,1-3H3;2*1-2H3/b4-3-;;; |
| InChIKey | WGFGSDLXODNUDR-FGSKAQBVSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|