C24H39N3O — CID 142907700
ethane;[(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate (PubChem CID 142907700) has the molecular formula C24H39N3O and a molecular weight of 385.60 g/mol. Its IUPAC name is ethane;[(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate.
| Compound Name | ethane;[(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate |
|---|---|
| PubChem CID | 142907700 |
| Molecular Formula | C24H39N3O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | ethane;[(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate |
| SMILES | CC.[H]/N=C(\O/N=C/C(/C=C\C/C(C)=C/C=CC/C=C\C)=C/C)C1CCNCC1 |
| InChI | InChI=1S/C22H33N3O.C2H6/c1-4-6-7-8-9-11-19(3)12-10-13-20(5-2)18-25-26-22(23)21-14-16-24-17-15-21;1-2/h4-6,8-11,13,18,21,23-24H,7,12,14-17H2,1-3H3;1-2H3/b6-4-,9-8?,13-10-,19-11+,20-5+,23-22-,25-18+; |
| InChIKey | JPUMFQRAEFHSOM-WCPJNKPESA-N |
| XLogP | 6.35 |
| TPSA | 57.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|