C11H20N2 — CID 156796186
molecular hydrogen;N-[(1Z,3Z)-2-piperidin-4-ylpenta-1,3-dienyl]methanimine (PubChem CID 156796186) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is molecular hydrogen;N-[(1Z,3Z)-2-piperidin-4-ylpenta-1,3-dienyl]methanimine.
| Compound Name | molecular hydrogen;N-[(1Z,3Z)-2-piperidin-4-ylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 156796186 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | molecular hydrogen;N-[(1Z,3Z)-2-piperidin-4-ylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)C1CCNCC1.[H][H] |
| InChI | InChI=1S/C11H18N2.H2/c1-3-4-11(9-12-2)10-5-7-13-8-6-10;/h3-4,9-10,13H,2,5-8H2,1H3;1H/b4-3-,11-9+; |
| InChIKey | URFNUHMLZXJWPH-ZNTYGWNXSA-N |
| XLogP | 2.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|