C12H18FN — CID 134365700
4-[(1E,3Z,5Z)-1-fluorohepta-1,3,5-trien-4-yl]piperidine (PubChem CID 134365700) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 4-[(1E,3Z,5Z)-1-fluorohepta-1,3,5-trien-4-yl]piperidine.
| Compound Name | 4-[(1E,3Z,5Z)-1-fluorohepta-1,3,5-trien-4-yl]piperidine |
|---|---|
| PubChem CID | 134365700 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-[(1E,3Z,5Z)-1-fluorohepta-1,3,5-trien-4-yl]piperidine |
| SMILES | C/C=C\C(=C/C=C/F)C1CCNCC1 |
| InChI | InChI=1S/C12H18FN/c1-2-4-11(5-3-8-13)12-6-9-14-10-7-12/h2-5,8,12,14H,6-7,9-10H2,1H3/b4-2-,8-3+,11-5+ |
| InChIKey | RMHJOSTUFHQMCN-ZQMQWHACSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|