C13H19F3N2 — CID 143984943
N-[(1E,3E)-4-methyl-5-piperidin-4-yl-2-(trifluoromethyl)penta-1,3-dienyl]methanimine (PubChem CID 143984943) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-[(1E,3E)-4-methyl-5-piperidin-4-yl-2-(trifluoromethyl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-4-methyl-5-piperidin-4-yl-2-(trifluoromethyl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143984943 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[(1E,3E)-4-methyl-5-piperidin-4-yl-2-(trifluoromethyl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)CC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-10(7-11-3-5-18-6-4-11)8-12(9-17-2)13(14,15)16/h8-9,11,18H,2-7H2,1H3/b10-8+,12-9+ |
| InChIKey | FXQIXYXTBWCGOZ-AXDLQRQNSA-N |
| XLogP | 3.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|