C13H18F3N — CID 176663282
3-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]piperidine (PubChem CID 176663282) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is 3-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]piperidine.
| Compound Name | 3-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 176663282 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-[(3Z,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C(/C=C\C=C(/C)C(F)(F)F)C1CCCNC1 |
| InChI | InChI=1S/C13H18F3N/c1-10(12-7-4-8-17-9-12)5-3-6-11(2)13(14,15)16/h3,5-6,12,17H,1,4,7-9H2,2H3/b5-3-,11-6+ |
| InChIKey | MUXSYAQPWKYZDP-GGKXIICKSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|