C13H21N — CID 89292690
4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine (PubChem CID 89292690) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine.
| Compound Name | 4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 89292690 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]piperidine |
| SMILES | C=C/C(=C\C=C(C)C)C1CCNCC1 |
| InChI | InChI=1S/C13H21N/c1-4-12(6-5-11(2)3)13-7-9-14-10-8-13/h4-6,13-14H,1,7-10H2,2-3H3/b12-6+ |
| InChIKey | QJXXEHWGVZOFPB-WUXMJOGZSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|