C11H22N2 — CID 123193034
(E)-N-methyl-6-methylimino-4-propan-2-ylhex-4-en-1-amine (PubChem CID 123193034) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (E)-N-methyl-6-methylimino-4-propan-2-ylhex-4-en-1-amine.
| Compound Name | (E)-N-methyl-6-methylimino-4-propan-2-ylhex-4-en-1-amine |
|---|---|
| PubChem CID | 123193034 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (E)-N-methyl-6-methylimino-4-propan-2-ylhex-4-en-1-amine |
| SMILES | C/N=C/C=C(\CCCNC)C(C)C |
| InChI | InChI=1S/C11H22N2/c1-10(2)11(7-9-13-4)6-5-8-12-3/h7,9-10,12H,5-6,8H2,1-4H3/b11-7+,13-9+ |
| InChIKey | LRJKMIHNNDSIMD-IKHCGPGZSA-N |
| XLogP | 2.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|