C9H15N3 — CID 123571231
N'-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)propane-1,3-diimine (PubChem CID 123571231) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N'-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)propane-1,3-diimine.
| Compound Name | N'-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123571231 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N'-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)propane-1,3-diimine |
| SMILES | [H]/N=C/C(/C=N/C)C1=CCNCC1 |
| InChI | InChI=1S/C9H15N3/c1-11-7-9(6-10)8-2-4-12-5-3-8/h2,6-7,9-10,12H,3-5H2,1H3/b10-6+,11-7+ |
| InChIKey | FBAPWZVWPOBQDU-JMQWPVDRSA-N |
| XLogP | 0.87 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|