C15H26N2 — CID 123222540
1-cyclohexyl-N-(2,5-dihydropyridin-4-ylmethyl)propan-2-amine (PubChem CID 123222540) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-cyclohexyl-N-(2,5-dihydropyridin-4-ylmethyl)propan-2-amine.
| Compound Name | 1-cyclohexyl-N-(2,5-dihydropyridin-4-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 123222540 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-cyclohexyl-N-(2,5-dihydropyridin-4-ylmethyl)propan-2-amine |
| SMILES | CC(CC1CCCCC1)NCC1=CCN=CC1 |
| InChI | InChI=1S/C15H26N2/c1-13(11-14-5-3-2-4-6-14)17-12-15-7-9-16-10-8-15/h7,10,13-14,17H,2-6,8-9,11-12H2,1H3 |
| InChIKey | IOJSRLQJDBRSCC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|