C11H16N2 — CID 56634276
3a,5,6,7,8,8a,9,9a-octahydro-3H-pyrrolo[2,3-g]isoquinoline (PubChem CID 56634276) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3a,5,6,7,8,8a,9,9a-octahydro-3H-pyrrolo[2,3-g]isoquinoline.
| Compound Name | 3a,5,6,7,8,8a,9,9a-octahydro-3H-pyrrolo[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 56634276 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3a,5,6,7,8,8a,9,9a-octahydro-3H-pyrrolo[2,3-g]isoquinoline |
| SMILES | C1=NC2CC3CCNCC3=CC2C1 |
| InChI | InChI=1S/C11H16N2/c1-3-12-7-10-5-9-2-4-13-11(9)6-8(1)10/h4-5,8-9,11-12H,1-3,6-7H2 |
| InChIKey | NYOWLXDABZPPIS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|