C14H16N2 — CID 56994580
6,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-3,6,10,12-tetraene (PubChem CID 56994580) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 6,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-3,6,10,12-tetraene.
| Compound Name | 6,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-3,6,10,12-tetraene |
|---|---|
| PubChem CID | 56994580 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-3,6,10,12-tetraene |
| SMILES | C1=CCC2C(=C1)C1CC3=NCC=CC3C2N1 |
| InChI | InChI=1S/C14H16N2/c1-2-5-10-9(4-1)13-8-12-11(14(10)16-13)6-3-7-15-12/h1-4,6,10-11,13-14,16H,5,7-8H2 |
| InChIKey | PWCCTICINKVDSQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|