C14H20N2 — CID 123691188
1-(2,3,3a,4,5,6,7,9b-octahydro-1H-benzo[e]indol-9-yl)ethanimine (PubChem CID 123691188) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,9b-octahydro-1H-benzo[e]indol-9-yl)ethanimine.
| Compound Name | 1-(2,3,3a,4,5,6,7,9b-octahydro-1H-benzo[e]indol-9-yl)ethanimine |
|---|---|
| PubChem CID | 123691188 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,9b-octahydro-1H-benzo[e]indol-9-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CCCC2=C1C1CCNC1CC2 |
| InChI | InChI=1S/C14H20N2/c1-9(15)11-4-2-3-10-5-6-13-12(14(10)11)7-8-16-13/h4,12-13,15-16H,2-3,5-8H2,1H3/b15-9+ |
| InChIKey | MQSUREVVJVNQIW-OQLLNIDSSA-N |
| XLogP | 2.81 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|