C15H26N2 — CID 177350749
(Z)-3-(2-azabicyclo[2.2.1]hept-5-en-6-yl)-N-ethylpent-3-en-2-imine;ethane (PubChem CID 177350749) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (Z)-3-(2-azabicyclo[2.2.1]hept-5-en-6-yl)-N-ethylpent-3-en-2-imine;ethane.
| Compound Name | (Z)-3-(2-azabicyclo[2.2.1]hept-5-en-6-yl)-N-ethylpent-3-en-2-imine;ethane |
|---|---|
| PubChem CID | 177350749 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (Z)-3-(2-azabicyclo[2.2.1]hept-5-en-6-yl)-N-ethylpent-3-en-2-imine;ethane |
| SMILES | C/C=C(C1=CC2CNC1C2)\C(C)=N\CC.CC |
| InChI | InChI=1S/C13H20N2.C2H6/c1-4-11(9(3)14-5-2)12-6-10-7-13(12)15-8-10;1-2/h4,6,10,13,15H,5,7-8H2,1-3H3;1-2H3/b11-4+,14-9+; |
| InChIKey | HACGUANDHHSAOR-FVTMCAFCSA-N |
| XLogP | 3.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|